About 7-bromo-4-chloro-2,3-dihydrodibenzothiophene
7-bromo-4-chloro-2,3-dihydrodibenzothiophene (PubChem CID 170204754) has the molecular formula C12H8BrClS
and a molecular weight of 299.62 g/mol. Its IUPAC name is 7-bromo-4-chloro-2,3-dihydrodibenzothiophene.
Molecular Properties
| Compound Name | 7-bromo-4-chloro-2,3-dihydrodibenzothiophene |
| PubChem CID | 170204754 |
| Molecular Formula | C12H8BrClS |
| Molecular Weight | 299.62 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 7-bromo-4-chloro-2,3-dihydrodibenzothiophene |
| SMILES | ClC1=c2sc3cc(Br)ccc3c2=CCC1 |
| InChI | InChI=1S/C12H8BrClS/c13-7-4-5-8-9-2-1-3-10(14)12(9)15-11(8)6-7/h2,4-6H,1,3H2 |
| InChIKey | KPWHFCPDHFFJGU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-4-chloro-2,3-dihydrodibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-chloro-2,3-dihydrodibenzothiophene?
The IUPAC name of 7-bromo-4-chloro-2,3-dihydrodibenzothiophene (CID 170204754) is 7-bromo-4-chloro-2,3-dihydrodibenzothiophene.
What is the SMILES notation for 7-bromo-4-chloro-2,3-dihydrodibenzothiophene?
The canonical SMILES for 7-bromo-4-chloro-2,3-dihydrodibenzothiophene is ClC1=c2sc3cc(Br)ccc3c2=CCC1.
What is the InChIKey of 7-bromo-4-chloro-2,3-dihydrodibenzothiophene?
The InChIKey is KPWHFCPDHFFJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrClS/c13-7-4-5-8-9-2-1-3-10(14)12(9)15-11(8)6-7/h2,4-6H,1,3H2.
What are the key properties of 7-bromo-4-chloro-2,3-dihydrodibenzothiophene?
7-bromo-4-chloro-2,3-dihydrodibenzothiophene has a molecular weight of 299.62 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-chloro-2,3-dihydrodibenzothiophene is sourced from PubChem (CID 170204754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).