C22H27F3N4 — CID 170204756
5,5,5-trifluoro-N-[(1E)-2-[6-methylidene-1-[(5-propyl-2H-pyrrol-3-yl)methyl]pyridazin-3-yl]buta-1,3-dienyl]pentan-2-imine (PubChem CID 170204756) has the molecular formula C22H27F3N4 and a molecular weight of 404.48 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(1E)-2-[6-methylidene-1-[(5-propyl-2H-pyrrol-3-yl)methyl]pyridazin-3-yl]buta-1,3-dienyl]pentan-2-imine.
| Compound Name | 5,5,5-trifluoro-N-[(1E)-2-[6-methylidene-1-[(5-propyl-2H-pyrrol-3-yl)methyl]pyridazin-3-yl]buta-1,3-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 170204756 |
| Molecular Formula | C22H27F3N4 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 5,5,5-trifluoro-N-[(1E)-2-[6-methylidene-1-[(5-propyl-2H-pyrrol-3-yl)methyl]pyridazin-3-yl]buta-1,3-dienyl]pentan-2-imine |
| SMILES | C=C/C(=C\N=C(/C)CCC(F)(F)F)C1=NN(CC2=CC(CCC)=NC2)C(=C)C=C1 |
| InChI | InChI=1S/C22H27F3N4/c1-5-7-20-12-18(13-27-20)15-29-17(4)8-9-21(28-29)19(6-2)14-26-16(3)10-11-22(23,24)25/h6,8-9,12,14H,2,4-5,7,10-11,13,15H2,1,3H3/b19-14+,26-16+ |
| InChIKey | AVJXVHWWHULKRO-ILEHTTPLSA-N |
| XLogP | 5.78 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|