C40H72FN — CID 170205144
[2-ethyl-3-[(1Z)-1-[4-[1-(2-fluoro-3,4,5-trimethyl-6-propylcyclohexyl)prop-2-enyl]-2,6-dimethyl-3-propan-2-ylcyclohexylidene]ethyl]-4,5,6-trimethylcyclohexyl]methanamine (PubChem CID 170205144) has the molecular formula C40H72FN and a molecular weight of 586.02 g/mol. Its IUPAC name is [2-ethyl-3-[(1Z)-1-[4-[1-(2-fluoro-3,4,5-trimethyl-6-propylcyclohexyl)prop-2-enyl]-2,6-dimethyl-3-propan-2-ylcyclohexylidene]ethyl]-4,5,6-trimethylcyclohexyl]methanamine.
| Compound Name | [2-ethyl-3-[(1Z)-1-[4-[1-(2-fluoro-3,4,5-trimethyl-6-propylcyclohexyl)prop-2-enyl]-2,6-dimethyl-3-propan-2-ylcyclohexylidene]ethyl]-4,5,6-trimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 170205144 |
| Molecular Formula | C40H72FN |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 585.56 |
| IUPAC Name | [2-ethyl-3-[(1Z)-1-[4-[1-(2-fluoro-3,4,5-trimethyl-6-propylcyclohexyl)prop-2-enyl]-2,6-dimethyl-3-propan-2-ylcyclohexylidene]ethyl]-4,5,6-trimethylcyclohexyl]methanamine |
| SMILES | C=CC(C1CC(C)/C(=C(\C)C2C(C)C(C)C(C)C(CN)C2CC)C(C)C1C(C)C)C1C(F)C(C)C(C)C(C)C1CCC |
| InChI | InChI=1S/C40H72FN/c1-15-18-33-25(9)24(8)28(12)40(41)39(33)31(16-2)34-19-22(6)37(29(13)36(34)21(4)5)30(14)38-27(11)23(7)26(10)35(20-42)32(38)17-3/h16,21-29,31-36,38-40H,2,15,17-20,42H2,1,3-14H3/b37-30- |
| InChIKey | JWGYHDQAWHUYBG-ONQIKCEGSA-N |
| XLogP | 11.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|