C13H18N2 — CID 170205699
3-methyl-8-phenyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170205699) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-methyl-8-phenyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-methyl-8-phenyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170205699 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-methyl-8-phenyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CN1CC2CCC(C1)N2c1ccccc1 |
| InChI | InChI=1S/C13H18N2/c1-14-9-12-7-8-13(10-14)15(12)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| InChIKey | IRPZCQBDVVAQCE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |