About (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine
(Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine (PubChem CID 170205759) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine.
Molecular Properties
| Compound Name | (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine |
| PubChem CID | 170205759 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine |
| SMILES | C=NN/C(=C(\N)CC)C(C)(C)C |
| InChI | InChI=1S/C9H19N3/c1-6-7(10)8(12-11-5)9(2,3)4/h12H,5-6,10H2,1-4H3/b8-7- |
| InChIKey | SCDWFIVUBQRUKW-FPLPWBNLSA-N |
| XLogP | 1.82 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine?
The IUPAC name of (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine (CID 170205759) is (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine.
What is the SMILES notation for (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine?
The canonical SMILES for (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine is C=NN/C(=C(\N)CC)C(C)(C)C.
What is the InChIKey of (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine?
The InChIKey is SCDWFIVUBQRUKW-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H19N3/c1-6-7(10)8(12-11-5)9(2,3)4/h12H,5-6,10H2,1-4H3/b8-7-.
What are the key properties of (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine?
(Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine has a molecular weight of 169.27 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,2-dimethyl-3-N-(methylideneamino)hex-3-ene-3,4-diamine is sourced from PubChem (CID 170205759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).