C15H25N5O3 — CID 17020577
1,5-dimethyl-4-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazole-3-carboxamide (PubChem CID 17020577) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1,5-dimethyl-4-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazole-3-carboxamide.
| Compound Name | 1,5-dimethyl-4-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17020577 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1,5-dimethyl-4-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazole-3-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(=O)NC2CC(C)(C)NC(C)(C)C2)nn1C |
| InChI | InChI=1S/C15H25N5O3/c1-9-12(20(22)23)11(17-19(9)6)13(21)16-10-7-14(2,3)18-15(4,5)8-10/h10,18H,7-8H2,1-6H3,(H,16,21) |
| InChIKey | QYBXHJZDAVNQRQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|