C18H16IN3O3 — CID 170206613
2-(6,7-dimethoxy-1,5-naphthyridin-4-yl)-3-iodo-1,5,6,7-tetrahydroindol-4-one (PubChem CID 170206613) has the molecular formula C18H16IN3O3 and a molecular weight of 449.25 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1,5-naphthyridin-4-yl)-3-iodo-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 2-(6,7-dimethoxy-1,5-naphthyridin-4-yl)-3-iodo-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 170206613 |
| Molecular Formula | C18H16IN3O3 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-(6,7-dimethoxy-1,5-naphthyridin-4-yl)-3-iodo-1,5,6,7-tetrahydroindol-4-one |
| SMILES | COc1cc2nccc(-c3[nH]c4c(c3I)C(=O)CCC4)c2nc1OC |
| InChI | InChI=1S/C18H16IN3O3/c1-24-13-8-11-16(22-18(13)25-2)9(6-7-20-11)17-15(19)14-10(21-17)4-3-5-12(14)23/h6-8,21H,3-5H2,1-2H3 |
| InChIKey | URBWMFKBTMSSFJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|