C21H25N2O+ — CID 170207504
3-(3,6-dimethyldibenzofuran-4-yl)-1,1,2,2-tetramethylimidazol-1-ium (PubChem CID 170207504) has the molecular formula C21H25N2O+ and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-(3,6-dimethyldibenzofuran-4-yl)-1,1,2,2-tetramethylimidazol-1-ium.
| Compound Name | 3-(3,6-dimethyldibenzofuran-4-yl)-1,1,2,2-tetramethylimidazol-1-ium |
|---|---|
| PubChem CID | 170207504 |
| Molecular Formula | C21H25N2O+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-(3,6-dimethyldibenzofuran-4-yl)-1,1,2,2-tetramethylimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3c(C)cccc32)c1N1C=C[N+](C)(C)C1(C)C |
| InChI | InChI=1S/C21H25N2O/c1-14-10-11-17-16-9-7-8-15(2)19(16)24-20(17)18(14)22-12-13-23(5,6)21(22,3)4/h7-13H,1-6H3/q+1 |
| InChIKey | PXUNNBLTCYRZPV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|