About (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane
(2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane (PubChem CID 170208209) has the molecular formula C9H17BrN2
and a molecular weight of 233.15 g/mol. Its IUPAC name is (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane.
Molecular Properties
| Compound Name | (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane |
| PubChem CID | 170208209 |
| Molecular Formula | C9H17BrN2 |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane |
| SMILES | C=C1CC(Br)NC[C@@H](C)N(C)C1 |
| InChI | InChI=1S/C9H17BrN2/c1-7-4-9(10)11-5-8(2)12(3)6-7/h8-9,11H,1,4-6H2,2-3H3/t8-,9?/m1/s1 |
| InChIKey | XIIFTOIBTZUKTB-VEDVMXKPSA-N |
| XLogP | 1.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane?
The IUPAC name of (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane (CID 170208209) is (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane.
What is the SMILES notation for (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane?
The canonical SMILES for (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane is C=C1CC(Br)NC[C@@H](C)N(C)C1.
What is the InChIKey of (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane?
The InChIKey is XIIFTOIBTZUKTB-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H17BrN2/c1-7-4-9(10)11-5-8(2)12(3)6-7/h8-9,11H,1,4-6H2,2-3H3/t8-,9?/m1/s1.
What are the key properties of (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane?
(2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane has a molecular weight of 233.15 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-bromo-1,2-dimethyl-7-methylidene-1,4-diazocane is sourced from PubChem (CID 170208209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).