About (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine
(3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine (PubChem CID 170208323) has the molecular formula C14H19F3N2O
and a molecular weight of 288.31 g/mol. Its IUPAC name is (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine.
Molecular Properties
| Compound Name | (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
| PubChem CID | 170208323 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
| SMILES | C[C@H]1CN(C)CC[C@H]1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O/c1-10-9-19(2)8-7-13(10)18-11-3-5-12(6-4-11)20-14(15,16)17/h3-6,10,13,18H,7-9H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | QROPMZBAUFABNC-GXFFZTMASA-N |
| XLogP | 3.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine?
The IUPAC name of (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine (CID 170208323) is (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine.
What is the SMILES notation for (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine?
The canonical SMILES for (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine is C[C@H]1CN(C)CC[C@H]1Nc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine?
The InChIKey is QROPMZBAUFABNC-GXFFZTMASA-N. The full InChI is InChI=1S/C14H19F3N2O/c1-10-9-19(2)8-7-13(10)18-11-3-5-12(6-4-11)20-14(15,16)17/h3-6,10,13,18H,7-9H2,1-2H3/t10-,13+/m0/s1.
What are the key properties of (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine?
(3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine has a molecular weight of 288.31 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1,3-dimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine is sourced from PubChem (CID 170208323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).