C17H13N5O2 — CID 170208412
(2E)-2-hydroxyimino-6-(pyrazin-2-ylmethyl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-9-one (PubChem CID 170208412) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-6-(pyrazin-2-ylmethyl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-9-one.
| Compound Name | (2E)-2-hydroxyimino-6-(pyrazin-2-ylmethyl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-9-one |
|---|---|
| PubChem CID | 170208412 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2E)-2-hydroxyimino-6-(pyrazin-2-ylmethyl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-9-one |
| SMILES | O=C1Cc2c(ncn2Cc2cnccn2)/C(=N/O)c2ccccc21 |
| InChI | InChI=1S/C17H13N5O2/c23-15-7-14-17(16(21-24)13-4-2-1-3-12(13)15)20-10-22(14)9-11-8-18-5-6-19-11/h1-6,8,10,24H,7,9H2/b21-16+ |
| InChIKey | SDHBFDUIPJUNBO-LTGZKZEYSA-N |
| XLogP | 1.69 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|