C23H14F6N4O3 — CID 17020863
N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 17020863) has the molecular formula C23H14F6N4O3 and a molecular weight of 508.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 17020863 |
| Molecular Formula | C23H14F6N4O3 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cc2nc(-c3ccc(F)cc3)cc(C(F)(F)C(F)(F)F)n2n1 |
| InChI | InChI=1S/C23H14F6N4O3/c24-14-4-2-13(3-5-14)15-8-19(22(25,26)23(27,28)29)33-20(31-15)9-16(32-33)21(34)30-10-12-1-6-17-18(7-12)36-11-35-17/h1-9H,10-11H2,(H,30,34) |
| InChIKey | GZABBTHGILKDMQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|