About (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one
(4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one (PubChem CID 170208852) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one.
Molecular Properties
| Compound Name | (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one |
| PubChem CID | 170208852 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one |
| SMILES | CCO/N=C1/C(C)=C(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H15NO2/c1-4-17-15-13-9(2)10(3)14(16)12-8-6-5-7-11(12)13/h5-8H,4H2,1-3H3/b15-13- |
| InChIKey | BHGHOGVWGPSZFH-SQFISAMPSA-N |
| XLogP | 2.96 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one?
The IUPAC name of (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one (CID 170208852) is (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one.
What is the SMILES notation for (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one?
The canonical SMILES for (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one is CCO/N=C1/C(C)=C(C)C(=O)c2ccccc21.
What is the InChIKey of (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one?
The InChIKey is BHGHOGVWGPSZFH-SQFISAMPSA-N. The full InChI is InChI=1S/C14H15NO2/c1-4-17-15-13-9(2)10(3)14(16)12-8-6-5-7-11(12)13/h5-8H,4H2,1-3H3/b15-13-.
What are the key properties of (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one?
(4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one has a molecular weight of 229.28 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethoxyimino-2,3-dimethylnaphthalen-1-one is sourced from PubChem (CID 170208852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).