C19H17ClFIN4O2 — CID 170209336
N-[(2-chloro-3-fluorophenyl)methyl]-N-iodo-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 170209336) has the molecular formula C19H17ClFIN4O2 and a molecular weight of 514.73 g/mol. Its IUPAC name is N-[(2-chloro-3-fluorophenyl)methyl]-N-iodo-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[(2-chloro-3-fluorophenyl)methyl]-N-iodo-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 170209336 |
| Molecular Formula | C19H17ClFIN4O2 |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | N-[(2-chloro-3-fluorophenyl)methyl]-N-iodo-6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncnc(NC3(C)CC3)c2c1C(=O)N(I)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C19H17ClFIN4O2/c1-10-13(18(27)26(22)8-11-4-3-5-12(21)15(11)20)14-16(25-19(2)6-7-19)23-9-24-17(14)28-10/h3-5,9H,6-8H2,1-2H3,(H,23,24,25) |
| InChIKey | VNAZZSMPCWGEET-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|