C21H24N4O3 — CID 170209511
6-methyl-4-[(1-methylcyclopropyl)amino]-N-[2-(2-methylphenoxy)ethyl]furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 170209511) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 6-methyl-4-[(1-methylcyclopropyl)amino]-N-[2-(2-methylphenoxy)ethyl]furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 6-methyl-4-[(1-methylcyclopropyl)amino]-N-[2-(2-methylphenoxy)ethyl]furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 170209511 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-methyl-4-[(1-methylcyclopropyl)amino]-N-[2-(2-methylphenoxy)ethyl]furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)c1c(C)oc2ncnc(NC3(C)CC3)c12 |
| InChI | InChI=1S/C21H24N4O3/c1-13-6-4-5-7-15(13)27-11-10-22-19(26)16-14(2)28-20-17(16)18(23-12-24-20)25-21(3)8-9-21/h4-7,12H,8-11H2,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | FFDIJEXXMSQSAX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|