C18H18N8O2 — CID 170209782
(14R)-7,14-dimethyl-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one (PubChem CID 170209782) has the molecular formula C18H18N8O2 and a molecular weight of 378.40 g/mol. Its IUPAC name is (14R)-7,14-dimethyl-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one.
| Compound Name | (14R)-7,14-dimethyl-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one |
|---|---|
| PubChem CID | 170209782 |
| Molecular Formula | C18H18N8O2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (14R)-7,14-dimethyl-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one |
| SMILES | C[C@@H]1COCc2cc(c3nnn(C)c3c2)Nc2ccc3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C18H18N8O2/c1-10-8-28-9-11-5-12(17-13(6-11)25(2)24-22-17)21-15-3-4-16-19-7-14(18(27)20-10)26(16)23-15/h3-7,10H,8-9H2,1-2H3,(H,20,27)(H,21,23)/t10-/m1/s1 |
| InChIKey | PIUIIZPULRGJDU-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |