C22H31N2+ — CID 170209907
2-[2-(2,3-dihydro-1H-inden-2-yl)propyl]-6-propan-2-yl-4,5,6,7-tetrahydro-1H-indazol-2-ium (PubChem CID 170209907) has the molecular formula C22H31N2+ and a molecular weight of 323.50 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-inden-2-yl)propyl]-6-propan-2-yl-4,5,6,7-tetrahydro-1H-indazol-2-ium.
| Compound Name | 2-[2-(2,3-dihydro-1H-inden-2-yl)propyl]-6-propan-2-yl-4,5,6,7-tetrahydro-1H-indazol-2-ium |
|---|---|
| PubChem CID | 170209907 |
| Molecular Formula | C22H31N2+ |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-inden-2-yl)propyl]-6-propan-2-yl-4,5,6,7-tetrahydro-1H-indazol-2-ium |
| SMILES | CC(C)C1CCc2c[n+](CC(C)C3Cc4ccccc4C3)[nH]c2C1 |
| InChI | InChI=1S/C22H30N2/c1-15(2)17-8-9-20-14-24(23-22(20)12-17)13-16(3)21-10-18-6-4-5-7-19(18)11-21/h4-7,14-17,21H,8-13H2,1-3H3/p+1 |
| InChIKey | XZVHIYNXZGFOTI-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|