C23H35N — CID 170210109
3-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-5-[(5Z)-octa-2,3,5-trienyl]-3-propyl-2,4-dihydropyrrole (PubChem CID 170210109) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is 3-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-5-[(5Z)-octa-2,3,5-trienyl]-3-propyl-2,4-dihydropyrrole.
| Compound Name | 3-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-5-[(5Z)-octa-2,3,5-trienyl]-3-propyl-2,4-dihydropyrrole |
|---|---|
| PubChem CID | 170210109 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 3-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-5-[(5Z)-octa-2,3,5-trienyl]-3-propyl-2,4-dihydropyrrole |
| SMILES | C/C=C\C=C(/CC)CC1(CCC)CN=C(CC=C=C/C=C\CC)C1 |
| InChI | InChI=1S/C23H35N/c1-5-9-11-12-13-14-16-22-19-23(17-7-3,20-24-22)18-21(8-4)15-10-6-2/h6,9-12,14-15H,5,7-8,16-20H2,1-4H3/b10-6-,11-9-,21-15+ |
| InChIKey | ZGKXHQITLVCARF-ANVVTKTDSA-N |
| XLogP | 6.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|