C18H28N+ — CID 170210374
[(1E,4E,6E,9Z)-2-ethenyl-6-methylundeca-1,4,6,9-tetraenyl]-methyl-propylideneazanium (PubChem CID 170210374) has the molecular formula C18H28N+ and a molecular weight of 258.43 g/mol. Its IUPAC name is [(1E,4E,6E,9Z)-2-ethenyl-6-methylundeca-1,4,6,9-tetraenyl]-methyl-propylideneazanium.
| Compound Name | [(1E,4E,6E,9Z)-2-ethenyl-6-methylundeca-1,4,6,9-tetraenyl]-methyl-propylideneazanium |
|---|---|
| PubChem CID | 170210374 |
| Molecular Formula | C18H28N+ |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | [(1E,4E,6E,9Z)-2-ethenyl-6-methylundeca-1,4,6,9-tetraenyl]-methyl-propylideneazanium |
| SMILES | C=C/C(=C/[N+](C)=C/CC)C/C=C/C(C)=C/C/C=C\C |
| InChI | InChI=1S/C18H28N/c1-6-9-10-12-17(4)13-11-14-18(8-3)16-19(5)15-7-2/h6,8-9,11-13,15-16H,3,7,10,14H2,1-2,4-5H3/q+1/b9-6-,13-11+,17-12+,18-16-,19-15+ |
| InChIKey | DYXZDNUKZFHUSK-QAYRLNMHSA-N |
| XLogP | 5.04 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|