About (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine
(Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine (PubChem CID 170210538) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine |
| PubChem CID | 170210538 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine |
| SMILES | C/C=C\C/C(=C\C)OC(/C=C\C)N(C)CC |
| InChI | InChI=1S/C14H25NO/c1-6-10-12-13(8-3)16-14(11-7-2)15(5)9-4/h6-8,10-11,14H,9,12H2,1-5H3/b10-6-,11-7-,13-8+ |
| InChIKey | KAGQLYHTPMSOCW-XLFPVRRESA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine?
The IUPAC name of (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine (CID 170210538) is (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine.
What is the SMILES notation for (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine?
The canonical SMILES for (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine is C/C=C\C/C(=C\C)OC(/C=C\C)N(C)CC.
What is the InChIKey of (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine?
The InChIKey is KAGQLYHTPMSOCW-XLFPVRRESA-N. The full InChI is InChI=1S/C14H25NO/c1-6-10-12-13(8-3)16-14(11-7-2)15(5)9-4/h6-8,10-11,14H,9,12H2,1-5H3/b10-6-,11-7-,13-8+.
What are the key properties of (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine?
(Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine has a molecular weight of 223.36 g/mol, XLogP of 3.73, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-1-[(2E,5Z)-hepta-2,5-dien-3-yl]oxy-N-methylbut-2-en-1-amine is sourced from PubChem (CID 170210538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).