About (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine
(Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine (PubChem CID 170210822) has the molecular formula C8H13I2N
and a molecular weight of 377.01 g/mol. Its IUPAC name is (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine.
Molecular Properties
| Compound Name | (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine |
| PubChem CID | 170210822 |
| Molecular Formula | C8H13I2N |
| Molecular Weight | 377.01 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine |
| SMILES | C/C=C\C(=C/C)[C@H](C)N(I)I |
| InChI | InChI=1S/C8H13I2N/c1-4-6-8(5-2)7(3)11(9)10/h4-7H,1-3H3/b6-4-,8-5+/t7-/m0/s1 |
| InChIKey | OSVRUNJHPXLYCN-QCIZFYSZSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine?
The IUPAC name of (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine (CID 170210822) is (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine.
What is the SMILES notation for (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine?
The canonical SMILES for (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine is C/C=C\C(=C/C)[C@H](C)N(I)I.
What is the InChIKey of (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine?
The InChIKey is OSVRUNJHPXLYCN-QCIZFYSZSA-N. The full InChI is InChI=1S/C8H13I2N/c1-4-6-8(5-2)7(3)11(9)10/h4-7H,1-3H3/b6-4-,8-5+/t7-/m0/s1.
What are the key properties of (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine?
(Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine has a molecular weight of 377.01 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2S,3E)-3-ethylidene-N,N-diiodohex-4-en-2-amine is sourced from PubChem (CID 170210822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).