C22H17F3N6O4S — CID 17021096
4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one (PubChem CID 17021096) has the molecular formula C22H17F3N6O4S and a molecular weight of 518.48 g/mol. Its IUPAC name is 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one.
| Compound Name | 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
|---|---|
| PubChem CID | 17021096 |
| Molecular Formula | C22H17F3N6O4S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
| SMILES | COc1ccc(C2NC(=O)c3sc4nc(C(F)(F)F)cc(C)c4c3N2)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C22H17F3N6O4S/c1-10-5-15(22(23,24)25)27-21-16(10)17-18(36-21)20(32)29-19(28-17)11-3-4-14(35-2)12(6-11)8-30-9-13(7-26-30)31(33)34/h3-7,9,19,28H,8H2,1-2H3,(H,29,32) |
| InChIKey | XJTZMRWGPNQGDY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|