C32H33N7O2 — CID 170211326
N-[3-ethyl-5-[2-(methylamino)ethoxy]phenyl]-2,4-dimethyl-5-[2-[8-(1H-pyrazol-4-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide (PubChem CID 170211326) has the molecular formula C32H33N7O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[3-ethyl-5-[2-(methylamino)ethoxy]phenyl]-2,4-dimethyl-5-[2-[8-(1H-pyrazol-4-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide.
| Compound Name | N-[3-ethyl-5-[2-(methylamino)ethoxy]phenyl]-2,4-dimethyl-5-[2-[8-(1H-pyrazol-4-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 170211326 |
| Molecular Formula | C32H33N7O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[3-ethyl-5-[2-(methylamino)ethoxy]phenyl]-2,4-dimethyl-5-[2-[8-(1H-pyrazol-4-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide |
| SMILES | CCc1cc(NC(=O)c2cc(C#Cc3cnc4c(Nc5cn[nH]c5)cccn34)c(C)cc2C)cc(OCCNC)c1 |
| InChI | InChI=1S/C32H33N7O2/c1-5-23-14-25(17-28(15-23)41-12-10-33-4)38-32(40)29-16-24(21(2)13-22(29)3)8-9-27-20-34-31-30(7-6-11-39(27)31)37-26-18-35-36-19-26/h6-7,11,13-20,33,37H,5,10,12H2,1-4H3,(H,35,36)(H,38,40) |
| InChIKey | JTINKLGTUVSNNK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|