C19H23N3O3 — CID 170211419
2-methyl-6-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)oxane-3,5-diol (PubChem CID 170211419) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-methyl-6-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)oxane-3,5-diol.
| Compound Name | 2-methyl-6-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)oxane-3,5-diol |
|---|---|
| PubChem CID | 170211419 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-methyl-6-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)oxane-3,5-diol |
| SMILES | CC1OC(N2CC3CC(C2)c2cc4nccnc4cc23)C(O)CC1O |
| InChI | InChI=1S/C19H23N3O3/c1-10-17(23)7-18(24)19(25-10)22-8-11-4-12(9-22)14-6-16-15(5-13(11)14)20-2-3-21-16/h2-3,5-6,10-12,17-19,23-24H,4,7-9H2,1H3 |
| InChIKey | FPRDSBMHEIWKEA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |