C22H19F3N4O — CID 170211631
2-[4-methyl-3-(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole (PubChem CID 170211631) has the molecular formula C22H19F3N4O and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[4-methyl-3-(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-methyl-3-(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 170211631 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[4-methyl-3-(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-c2nnc(CCCCc3ccc4cccnc4n3)o2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H19F3N4O/c1-14-8-9-16(13-18(14)22(23,24)25)21-29-28-19(30-21)7-3-2-6-17-11-10-15-5-4-12-26-20(15)27-17/h4-5,8-13H,2-3,6-7H2,1H3 |
| InChIKey | CFSXIBACUPIQFF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|