C14H26N2 — CID 170211720
(5E,7Z)-5-ethyl-2-imino-N,N-dimethyldeca-5,7-dien-1-amine (PubChem CID 170211720) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (5E,7Z)-5-ethyl-2-imino-N,N-dimethyldeca-5,7-dien-1-amine.
| Compound Name | (5E,7Z)-5-ethyl-2-imino-N,N-dimethyldeca-5,7-dien-1-amine |
|---|---|
| PubChem CID | 170211720 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (5E,7Z)-5-ethyl-2-imino-N,N-dimethyldeca-5,7-dien-1-amine |
| SMILES | [H]/N=C(/CC/C(=C/C=C\CC)CC)CN(C)C |
| InChI | InChI=1S/C14H26N2/c1-5-7-8-9-13(6-2)10-11-14(15)12-16(3)4/h7-9,15H,5-6,10-12H2,1-4H3/b8-7-,13-9+,15-14- |
| InChIKey | RSNFYWKLMUDMKY-XQHIENEASA-N |
| XLogP | 3.65 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|