C31H44O10 — CID 170211958
4-O-(1,3-diacetyloxypropan-2-yl) 1-O-[[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxymethyl] butanedioate (PubChem CID 170211958) has the molecular formula C31H44O10 and a molecular weight of 576.68 g/mol. Its IUPAC name is 4-O-(1,3-diacetyloxypropan-2-yl) 1-O-[[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxymethyl] butanedioate.
| Compound Name | 4-O-(1,3-diacetyloxypropan-2-yl) 1-O-[[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxymethyl] butanedioate |
|---|---|
| PubChem CID | 170211958 |
| Molecular Formula | C31H44O10 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 4-O-(1,3-diacetyloxypropan-2-yl) 1-O-[[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxymethyl] butanedioate |
| SMILES | CC(=O)OCC(COC(C)=O)OC(=O)CCC(=O)OCO[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H44O10/c1-19(32)37-16-23(17-38-20(2)33)41-29(36)10-9-28(35)40-18-39-27-8-7-25-24-6-5-21-15-22(34)11-13-30(21,3)26(24)12-14-31(25,27)4/h15,23-27H,5-14,16-18H2,1-4H3/t24-,25-,26-,27-,30-,31-/m0/s1 |
| InChIKey | FDYLQBSJMDTPOG-AXOMYGEFSA-N |
| XLogP | 4.22 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|