About (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine
(2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine (PubChem CID 170212214) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine.
Molecular Properties
| Compound Name | (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine |
| PubChem CID | 170212214 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine |
| SMILES | CC(C)O[C@@H](C)[C@H]1N(C)CC1(F)F |
| InChI | InChI=1S/C9H17F2NO/c1-6(2)13-7(3)8-9(10,11)5-12(8)4/h6-8H,5H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | KKDOBWPUZMAZFH-JGVFFNPUSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine?
The IUPAC name of (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine (CID 170212214) is (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine.
What is the SMILES notation for (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine?
The canonical SMILES for (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine is CC(C)O[C@@H](C)[C@H]1N(C)CC1(F)F.
What is the InChIKey of (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine?
The InChIKey is KKDOBWPUZMAZFH-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-6(2)13-7(3)8-9(10,11)5-12(8)4/h6-8H,5H2,1-4H3/t7-,8+/m0/s1.
What are the key properties of (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine?
(2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine has a molecular weight of 193.24 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-difluoro-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]azetidine is sourced from PubChem (CID 170212214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).