C16H21N3O2S — CID 17021247
4-cyclopropyl-3-[(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 17021247) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-cyclopropyl-3-[(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopropyl-3-[(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17021247 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-cyclopropyl-3-[(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(Cc2n[nH]c(=S)n2C2CC2)cc1OCC |
| InChI | InChI=1S/C16H21N3O2S/c1-3-20-13-8-5-11(9-14(13)21-4-2)10-15-17-18-16(22)19(15)12-6-7-12/h5,8-9,12H,3-4,6-7,10H2,1-2H3,(H,18,22) |
| InChIKey | DZQIXSKCATUDMX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|