C15H33NO — CID 170212607
2-(dimethylamino)-2,5,8,8-tetramethylnonan-3-ol (PubChem CID 170212607) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is 2-(dimethylamino)-2,5,8,8-tetramethylnonan-3-ol.
| Compound Name | 2-(dimethylamino)-2,5,8,8-tetramethylnonan-3-ol |
|---|---|
| PubChem CID | 170212607 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 2-(dimethylamino)-2,5,8,8-tetramethylnonan-3-ol |
| SMILES | CC(CCC(C)(C)C)CC(O)C(C)(C)N(C)C |
| InChI | InChI=1S/C15H33NO/c1-12(9-10-14(2,3)4)11-13(17)15(5,6)16(7)8/h12-13,17H,9-11H2,1-8H3 |
| InChIKey | JPDUAJYRPKWVFW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |