C16H23FN2 — CID 170213094
(3Z)-2-N-[(3E,5E)-6-fluoroocta-3,5,7-trienyl]-5-N,5-N-dimethylhexa-1,3,5-triene-2,5-diamine (PubChem CID 170213094) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (3Z)-2-N-[(3E,5E)-6-fluoroocta-3,5,7-trienyl]-5-N,5-N-dimethylhexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-2-N-[(3E,5E)-6-fluoroocta-3,5,7-trienyl]-5-N,5-N-dimethylhexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 170213094 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3Z)-2-N-[(3E,5E)-6-fluoroocta-3,5,7-trienyl]-5-N,5-N-dimethylhexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C/C(F)=C\C=C\CCNC(=C)/C=C\C(=C)N(C)C |
| InChI | InChI=1S/C16H23FN2/c1-6-16(17)10-8-7-9-13-18-14(2)11-12-15(3)19(4)5/h6-8,10-12,18H,1-3,9,13H2,4-5H3/b8-7+,12-11-,16-10+ |
| InChIKey | JVMBWXLFLBNELH-PFYGOLHFSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|