C32H42N4O2S — CID 170213224
tert-butyl (3S,5S)-3,5-dimethyl-4-[6-methyl-7-(3-methylnaphthalen-1-yl)-2-methylsulfanyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 170213224) has the molecular formula C32H42N4O2S and a molecular weight of 546.78 g/mol. Its IUPAC name is tert-butyl (3S,5S)-3,5-dimethyl-4-[6-methyl-7-(3-methylnaphthalen-1-yl)-2-methylsulfanyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S,5S)-3,5-dimethyl-4-[6-methyl-7-(3-methylnaphthalen-1-yl)-2-methylsulfanyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170213224 |
| Molecular Formula | C32H42N4O2S |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | tert-butyl (3S,5S)-3,5-dimethyl-4-[6-methyl-7-(3-methylnaphthalen-1-yl)-2-methylsulfanyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CSc1nc2c(c(N3[C@@H](C)CN(C(=O)OC(C)(C)C)C[C@@H]3C)n1)CC(C)C(c1cc(C)cc3ccccc13)C2 |
| InChI | InChI=1S/C32H42N4O2S/c1-19-13-23-11-9-10-12-24(23)26(14-19)25-16-28-27(15-20(25)2)29(34-30(33-28)39-8)36-21(3)17-35(18-22(36)4)31(37)38-32(5,6)7/h9-14,20-22,25H,15-18H2,1-8H3/t20?,21-,22-,25?/m0/s1 |
| InChIKey | YDSWEKFXDDUZRV-NFJKTXFASA-N |
| XLogP | 7.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |