C12H15N5O3 — CID 170213406
(1R,10S,11S)-11-azido-10-ethyl-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one (PubChem CID 170213406) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is (1R,10S,11S)-11-azido-10-ethyl-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one.
| Compound Name | (1R,10S,11S)-11-azido-10-ethyl-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one |
|---|---|
| PubChem CID | 170213406 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (1R,10S,11S)-11-azido-10-ethyl-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one |
| SMILES | CC[C@@]12COc3nc(=O)c(C)cn3[C@@H](C[C@@H]1N=[N+]=[N-])O2 |
| InChI | InChI=1S/C12H15N5O3/c1-3-12-6-19-11-14-10(18)7(2)5-17(11)9(20-12)4-8(12)15-16-13/h5,8-9H,3-4,6H2,1-2H3/t8-,9+,12+/m0/s1 |
| InChIKey | URAWHQJLORYZMV-YGOYTEALSA-N |
| XLogP | 1.69 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|