About 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine
2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine (PubChem CID 170213646) has the molecular formula C10H9F3N2O2S
and a molecular weight of 278.26 g/mol. Its IUPAC name is 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine |
| PubChem CID | 170213646 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1nc2cc(S(=O)(=O)C(F)(F)F)ccn2c1C |
| InChI | InChI=1S/C10H9F3N2O2S/c1-6-7(2)15-4-3-8(5-9(15)14-6)18(16,17)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | BOTBZQCFPFXHJY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine?
The IUPAC name of 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine (CID 170213646) is 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine is Cc1nc2cc(S(=O)(=O)C(F)(F)F)ccn2c1C.
What is the InChIKey of 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine?
The InChIKey is BOTBZQCFPFXHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O2S/c1-6-7(2)15-4-3-8(5-9(15)14-6)18(16,17)10(11,12)13/h3-5H,1-2H3.
What are the key properties of 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine?
2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine has a molecular weight of 278.26 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-(trifluoromethylsulfonyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 170213646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).