C8H6F4N4 — CID 170213685
2-methyl-7-(1,2,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 170213685) has the molecular formula C8H6F4N4 and a molecular weight of 234.16 g/mol. Its IUPAC name is 2-methyl-7-(1,2,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 2-methyl-7-(1,2,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 170213685 |
| Molecular Formula | C8H6F4N4 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-methyl-7-(1,2,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | Cc1nc2cc(C(F)C(F)(F)F)ncn2n1 |
| InChI | InChI=1S/C8H6F4N4/c1-4-14-6-2-5(7(9)8(10,11)12)13-3-16(6)15-4/h2-3,7H,1H3 |
| InChIKey | GYSUEEROXIRHCD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |