C27H44N2 — CID 170213848
N-methyl-4-[4-[4-(4-methylpiperidin-1-yl)butyl]-2,4a,5,8,9,9a-hexahydro-1H-benzo[7]annulen-7-yl]pent-4-en-2-imine (PubChem CID 170213848) has the molecular formula C27H44N2 and a molecular weight of 396.66 g/mol. Its IUPAC name is N-methyl-4-[4-[4-(4-methylpiperidin-1-yl)butyl]-2,4a,5,8,9,9a-hexahydro-1H-benzo[7]annulen-7-yl]pent-4-en-2-imine.
| Compound Name | N-methyl-4-[4-[4-(4-methylpiperidin-1-yl)butyl]-2,4a,5,8,9,9a-hexahydro-1H-benzo[7]annulen-7-yl]pent-4-en-2-imine |
|---|---|
| PubChem CID | 170213848 |
| Molecular Formula | C27H44N2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | N-methyl-4-[4-[4-(4-methylpiperidin-1-yl)butyl]-2,4a,5,8,9,9a-hexahydro-1H-benzo[7]annulen-7-yl]pent-4-en-2-imine |
| SMILES | C=C(C/C(C)=N/C)C1=CCC2C(CCCCN3CCC(C)CC3)=CCCC2CC1 |
| InChI | InChI=1S/C27H44N2/c1-21-15-18-29(19-16-21)17-6-5-8-25-9-7-10-26-12-11-24(13-14-27(25)26)22(2)20-23(3)28-4/h9,13,21,26-27H,2,5-8,10-12,14-20H2,1,3-4H3/b28-23+ |
| InChIKey | PRNOSARAYNKLLA-WEMUOSSPSA-N |
| XLogP | 6.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|