C15H26N2O2 — CID 170213917
2-[(5Z,8E)-2-methyl-4-propan-2-yl-3,7-dihydro-2H-1,4-diazecin-8-yl]ethoxymethanol (PubChem CID 170213917) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[(5Z,8E)-2-methyl-4-propan-2-yl-3,7-dihydro-2H-1,4-diazecin-8-yl]ethoxymethanol.
| Compound Name | 2-[(5Z,8E)-2-methyl-4-propan-2-yl-3,7-dihydro-2H-1,4-diazecin-8-yl]ethoxymethanol |
|---|---|
| PubChem CID | 170213917 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-[(5Z,8E)-2-methyl-4-propan-2-yl-3,7-dihydro-2H-1,4-diazecin-8-yl]ethoxymethanol |
| SMILES | CC1CN(C(C)C)/C=C\C/C(CCOCO)=C\C=N/1 |
| InChI | InChI=1S/C15H26N2O2/c1-13(2)17-9-4-5-15(7-10-19-12-18)6-8-16-14(3)11-17/h4,6,8-9,13-14,18H,5,7,10-12H2,1-3H3/b9-4-,15-6+,16-8- |
| InChIKey | MDZZGTNMKUNXRY-XEALBXCUSA-N |
| XLogP | 2.36 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|