C12H14ClN7S — CID 17021420
3-(4-chloro-1-ethylpyrazol-3-yl)-4-(1,3-dimethylpyrazol-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 17021420) has the molecular formula C12H14ClN7S and a molecular weight of 323.81 g/mol. Its IUPAC name is 3-(4-chloro-1-ethylpyrazol-3-yl)-4-(1,3-dimethylpyrazol-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chloro-1-ethylpyrazol-3-yl)-4-(1,3-dimethylpyrazol-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17021420 |
| Molecular Formula | C12H14ClN7S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-(4-chloro-1-ethylpyrazol-3-yl)-4-(1,3-dimethylpyrazol-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1cc(Cl)c(-c2n[nH]c(=S)n2-c2cn(C)nc2C)n1 |
| InChI | InChI=1S/C12H14ClN7S/c1-4-19-5-8(13)10(17-19)11-14-15-12(21)20(11)9-6-18(3)16-7(9)2/h5-6H,4H2,1-3H3,(H,15,21) |
| InChIKey | QMISJZYWJCZPEV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|