About (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine
(E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine (PubChem CID 170214322) has the molecular formula C10H15F3N2
and a molecular weight of 220.24 g/mol. Its IUPAC name is (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine.
Molecular Properties
| Compound Name | (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine |
| PubChem CID | 170214322 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C(=C(\C=N\[H])C(F)(F)F)C(C)C(C)C |
| InChI | InChI=1S/C10H15F3N2/c1-6(2)7(3)8(4-14)9(5-15)10(11,12)13/h4-7,14-15H,1-3H3/b9-8-,14-4+,15-5+ |
| InChIKey | CZIDKPQOMFJHKJ-QBCAPYOMSA-N |
| XLogP | 3.44 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine?
The IUPAC name of (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine (CID 170214322) is (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine.
What is the SMILES notation for (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine?
The canonical SMILES for (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine is [H]/N=C/C(=C(\C=N\[H])C(F)(F)F)C(C)C(C)C.
What is the InChIKey of (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine?
The InChIKey is CZIDKPQOMFJHKJ-QBCAPYOMSA-N. The full InChI is InChI=1S/C10H15F3N2/c1-6(2)7(3)8(4-14)9(5-15)10(11,12)13/h4-7,14-15H,1-3H3/b9-8-,14-4+,15-5+.
What are the key properties of (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine?
(E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine has a molecular weight of 220.24 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(3-methylbutan-2-yl)-3-(trifluoromethyl)but-2-ene-1,4-diimine is sourced from PubChem (CID 170214322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).