C20H13F3N4O3 — CID 170214342
phenyl 4-[4-(trifluoromethylamino)phenoxy]pyrrolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 170214342) has the molecular formula C20H13F3N4O3 and a molecular weight of 414.34 g/mol. Its IUPAC name is phenyl 4-[4-(trifluoromethylamino)phenoxy]pyrrolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | phenyl 4-[4-(trifluoromethylamino)phenoxy]pyrrolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 170214342 |
| Molecular Formula | C20H13F3N4O3 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | phenyl 4-[4-(trifluoromethylamino)phenoxy]pyrrolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | O=C(Oc1ccccc1)n1ccc2c(Oc3ccc(NC(F)(F)F)cc3)ncnc21 |
| InChI | InChI=1S/C20H13F3N4O3/c21-20(22,23)26-13-6-8-15(9-7-13)29-18-16-10-11-27(17(16)24-12-25-18)19(28)30-14-4-2-1-3-5-14/h1-12,26H |
| InChIKey | FCDCVESJJGLYJA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|