About 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole
3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole (PubChem CID 170215521) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole.
Molecular Properties
| Compound Name | 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole |
| PubChem CID | 170215521 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole |
| SMILES | CCC1=NCC(CC2=CC=CCC2)(CC(C)C)C1 |
| InChI | InChI=1S/C17H27N/c1-4-16-12-17(13-18-16,10-14(2)3)11-15-8-6-5-7-9-15/h5-6,8,14H,4,7,9-13H2,1-3H3 |
| InChIKey | FUIUFRJWVGZISN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole?
The IUPAC name of 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole (CID 170215521) is 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole.
What is the SMILES notation for 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole?
The canonical SMILES for 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole is CCC1=NCC(CC2=CC=CCC2)(CC(C)C)C1.
What is the InChIKey of 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole?
The InChIKey is FUIUFRJWVGZISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N/c1-4-16-12-17(13-18-16,10-14(2)3)11-15-8-6-5-7-9-15/h5-6,8,14H,4,7,9-13H2,1-3H3.
What are the key properties of 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole?
3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole has a molecular weight of 245.41 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexa-1,3-dien-1-ylmethyl)-5-ethyl-3-(2-methylpropyl)-2,4-dihydropyrrole is sourced from PubChem (CID 170215521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).