C19H23F2N — CID 170215966
3-[5-(3,5-difluorophenyl)-2,5-dimethylhexan-2-yl]pyridine (PubChem CID 170215966) has the molecular formula C19H23F2N and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-[5-(3,5-difluorophenyl)-2,5-dimethylhexan-2-yl]pyridine.
| Compound Name | 3-[5-(3,5-difluorophenyl)-2,5-dimethylhexan-2-yl]pyridine |
|---|---|
| PubChem CID | 170215966 |
| Molecular Formula | C19H23F2N |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-[5-(3,5-difluorophenyl)-2,5-dimethylhexan-2-yl]pyridine |
| SMILES | CC(C)(CCC(C)(C)c1cc(F)cc(F)c1)c1cccnc1 |
| InChI | InChI=1S/C19H23F2N/c1-18(2,14-6-5-9-22-13-14)7-8-19(3,4)15-10-16(20)12-17(21)11-15/h5-6,9-13H,7-8H2,1-4H3 |
| InChIKey | PDFIBGRJLRGJAN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |