About hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium
hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium (PubChem CID 170217527) has the molecular formula C4H11N3O2P+
and a molecular weight of 164.13 g/mol. Its IUPAC name is hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium.
Molecular Properties
| Compound Name | hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium |
| PubChem CID | 170217527 |
| Molecular Formula | C4H11N3O2P+ |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium |
| SMILES | C/N=C(\N)N(C)C[P+](=O)O |
| InChI | InChI=1S/C4H10N3O2P/c1-6-4(5)7(2)3-10(8)9/h3H2,1-2H3,(H2-,5,6,8,9)/p+1 |
| InChIKey | AAEQYKODWMWPHI-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium?
The IUPAC name of hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium (CID 170217527) is hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium.
What is the SMILES notation for hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium?
The canonical SMILES for hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium is C/N=C(\N)N(C)C[P+](=O)O.
What is the InChIKey of hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium?
The InChIKey is AAEQYKODWMWPHI-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10N3O2P/c1-6-4(5)7(2)3-10(8)9/h3H2,1-2H3,(H2-,5,6,8,9)/p+1.
What are the key properties of hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium?
hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium has a molecular weight of 164.13 g/mol, XLogP of -0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-oxophosphanium is sourced from PubChem (CID 170217527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).