C8H15FN2 — CID 170218444
(3R,3aS,6aS)-3-fluoro-1,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole (PubChem CID 170218444) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-fluoro-1,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole.
| Compound Name | (3R,3aS,6aS)-3-fluoro-1,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 170218444 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (3R,3aS,6aS)-3-fluoro-1,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
| SMILES | CN1C[C@H]2[C@@H](C1)N(C)C[C@@H]2F |
| InChI | InChI=1S/C8H15FN2/c1-10-3-6-7(9)4-11(2)8(6)5-10/h6-8H,3-5H2,1-2H3/t6-,7+,8-/m1/s1 |
| InChIKey | QEUVECLJPJWUTK-GJMOJQLCSA-N |
| XLogP | 0.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |