C7H8Br2F6O — CID 170218800
2-(1,3-dibromopropan-2-yloxy)-1,1,1,3,3,3-hexafluoro-2-methylpropane (PubChem CID 170218800) has the molecular formula C7H8Br2F6O and a molecular weight of 381.94 g/mol. Its IUPAC name is 2-(1,3-dibromopropan-2-yloxy)-1,1,1,3,3,3-hexafluoro-2-methylpropane.
| Compound Name | 2-(1,3-dibromopropan-2-yloxy)-1,1,1,3,3,3-hexafluoro-2-methylpropane |
|---|---|
| PubChem CID | 170218800 |
| Molecular Formula | C7H8Br2F6O |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | 2-(1,3-dibromopropan-2-yloxy)-1,1,1,3,3,3-hexafluoro-2-methylpropane |
| SMILES | CC(OC(CBr)CBr)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8Br2F6O/c1-5(6(10,11)12,7(13,14)15)16-4(2-8)3-9/h4H,2-3H2,1H3 |
| InChIKey | ANUVXCCHGOKQBA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|