C12H18F2INO — CID 170219217
(8S)-1',1'-difluoro-8-[[(1R)-1-iodoethoxy]methyl]spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] (PubChem CID 170219217) has the molecular formula C12H18F2INO and a molecular weight of 357.18 g/mol. Its IUPAC name is (8S)-1',1'-difluoro-8-[[(1R)-1-iodoethoxy]methyl]spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane].
| Compound Name | (8S)-1',1'-difluoro-8-[[(1R)-1-iodoethoxy]methyl]spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] |
|---|---|
| PubChem CID | 170219217 |
| Molecular Formula | C12H18F2INO |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (8S)-1',1'-difluoro-8-[[(1R)-1-iodoethoxy]methyl]spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] |
| SMILES | C[C@@H](I)OC[C@@]12CCCN1CC1(CC1(F)F)C2 |
| InChI | InChI=1S/C12H18F2INO/c1-9(15)17-8-11-3-2-4-16(11)7-10(5-11)6-12(10,13)14/h9H,2-8H2,1H3/t9-,10?,11-/m0/s1 |
| InChIKey | NPAUEMGJPDYBOV-JRUYECLLSA-N |
| XLogP | 3.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|