About 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one
2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 170220287) has the molecular formula C9H11N4O2+
and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one |
| PubChem CID | 170220287 |
| Molecular Formula | C9H11N4O2+ |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCc1nco[n+]1-c1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H10N4O2/c1-3-7-10-5-15-13(7)9-11-6(2)4-8(14)12-9/h4-5H,3H2,1-2H3/p+1 |
| InChIKey | ZSVITLBNKQEVPH-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one?
The IUPAC name of 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one (CID 170220287) is 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one is CCc1nco[n+]1-c1nc(C)cc(=O)[nH]1.
What is the InChIKey of 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one?
The InChIKey is ZSVITLBNKQEVPH-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10N4O2/c1-3-7-10-5-15-13(7)9-11-6(2)4-8(14)12-9/h4-5H,3H2,1-2H3/p+1.
What are the key properties of 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one?
2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one has a molecular weight of 207.21 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-1,2,4-oxadiazol-2-ium-2-yl)-4-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 170220287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).