C19H16Cl2N4O2 — CID 17022084
4-[(2,4-dichlorobenzoyl)amino]-1-ethyl-N-phenylpyrazole-3-carboxamide (PubChem CID 17022084) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is 4-[(2,4-dichlorobenzoyl)amino]-1-ethyl-N-phenylpyrazole-3-carboxamide.
| Compound Name | 4-[(2,4-dichlorobenzoyl)amino]-1-ethyl-N-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17022084 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-[(2,4-dichlorobenzoyl)amino]-1-ethyl-N-phenylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(Cl)cc2Cl)c(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H16Cl2N4O2/c1-2-25-11-16(23-18(26)14-9-8-12(20)10-15(14)21)17(24-25)19(27)22-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | NIFZKGCNOAGRND-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |