C20H21N3 — CID 170221146
2-N,3-N,4-trimethyl-2-N,3-N-diphenylpyridine-2,3-diamine (PubChem CID 170221146) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-N,3-N,4-trimethyl-2-N,3-N-diphenylpyridine-2,3-diamine.
| Compound Name | 2-N,3-N,4-trimethyl-2-N,3-N-diphenylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 170221146 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-N,3-N,4-trimethyl-2-N,3-N-diphenylpyridine-2,3-diamine |
| SMILES | Cc1ccnc(N(C)c2ccccc2)c1N(C)c1ccccc1 |
| InChI | InChI=1S/C20H21N3/c1-16-14-15-21-20(23(3)18-12-8-5-9-13-18)19(16)22(2)17-10-6-4-7-11-17/h4-15H,1-3H3 |
| InChIKey | FIFMIHFRANZNRO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |