About 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline
5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline (PubChem CID 170221276) has the molecular formula C29H25F2N
and a molecular weight of 425.52 g/mol. Its IUPAC name is 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline.
Molecular Properties
| Compound Name | 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline |
| PubChem CID | 170221276 |
| Molecular Formula | C29H25F2N |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline |
| SMILES | Cc1cc2c(c(-c3ncc(C)c4c(C5CCC(F)(F)C5)cccc34)c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C29H25F2N/c1-17-12-24-21-7-4-3-6-19(21)14-25(24)26(13-17)28-23-9-5-8-22(27(23)18(2)16-32-28)20-10-11-29(30,31)15-20/h3-9,12-13,16,20H,10-11,14-15H2,1-2H3 |
| InChIKey | QKCDGLNCDRWEEE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline?
The IUPAC name of 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline (CID 170221276) is 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline.
What is the SMILES notation for 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline?
The canonical SMILES for 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline is Cc1cc2c(c(-c3ncc(C)c4c(C5CCC(F)(F)C5)cccc34)c1)Cc1ccccc1-2.
What is the InChIKey of 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline?
The InChIKey is QKCDGLNCDRWEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25F2N/c1-17-12-24-21-7-4-3-6-19(21)14-25(24)26(13-17)28-23-9-5-8-22(27(23)18(2)16-32-28)20-10-11-29(30,31)15-20/h3-9,12-13,16,20H,10-11,14-15H2,1-2H3.
What are the key properties of 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline?
5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline has a molecular weight of 425.52 g/mol, XLogP of 7.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-difluorocyclopentyl)-4-methyl-1-(3-methyl-9H-fluoren-1-yl)isoquinoline is sourced from PubChem (CID 170221276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).